C23H31ClN4O6 — CID 22877912
(2S,3R)-2-amino-3-hydroxybutanamide;(E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile;hydrochloride (PubChem CID 22877912) has the molecular formula C23H31ClN4O6 and a molecular weight of 494.98 g/mol. Its IUPAC name is (2S,3R)-2-amino-3-hydroxybutanamide;(E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile;hydrochloride.
| Compound Name | (2S,3R)-2-amino-3-hydroxybutanamide;(E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile;hydrochloride |
|---|---|
| PubChem CID | 22877912 |
| Molecular Formula | C23H31ClN4O6 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | (2S,3R)-2-amino-3-hydroxybutanamide;(E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile;hydrochloride |
| SMILES | COc1ccc(/C=C(/C#N)c2cc(OC)c(OC)c(OC)c2)cc1N.C[C@@H](O)[C@H](N)C(N)=O.Cl |
| InChI | InChI=1S/C19H20N2O4.C4H10N2O2.ClH/c1-22-16-6-5-12(8-15(16)21)7-14(11-20)13-9-17(23-2)19(25-4)18(10-13)24-3;1-2(7)3(5)4(6)8;/h5-10H,21H2,1-4H3;2-3,7H,5H2,1H3,(H2,6,8);1H/b14-7-;;/t;2-,3+;/m.1./s1 |
| InChIKey | ZTICDOHJFGAXEY-WEYCVXBLSA-N |
| XLogP | 1.97 |
| TPSA | 176.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|