C25H35N7O5 — CID 22877827
(2R)-2-amino-5-(diaminomethylideneamino)pentanamide;(E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile (PubChem CID 22877827) has the molecular formula C25H35N7O5 and a molecular weight of 513.60 g/mol. Its IUPAC name is (2R)-2-amino-5-(diaminomethylideneamino)pentanamide;(E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (2R)-2-amino-5-(diaminomethylideneamino)pentanamide;(E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 22877827 |
| Molecular Formula | C25H35N7O5 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | (2R)-2-amino-5-(diaminomethylideneamino)pentanamide;(E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(/C#N)c2cc(OC)c(OC)c(OC)c2)cc1N.NC(=O)[C@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C19H20N2O4.C6H15N5O/c1-22-16-6-5-12(8-15(16)21)7-14(11-20)13-9-17(23-2)19(25-4)18(10-13)24-3;7-4(5(8)12)2-1-3-11-6(9)10/h5-10H,21H2,1-4H3;4H,1-3,7H2,(H2,8,12)(H4,9,10,11)/b14-7-;/t;4-/m.1/s1 |
| InChIKey | ZEFRYORWFPQWRE-GZTLRIRFSA-N |
| XLogP | 1.22 |
| TPSA | 220.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|