C26H34N4O7 — CID 22877895
(E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile;tert-butyl N-(2-amino-2-oxoethyl)carbamate (PubChem CID 22877895) has the molecular formula C26H34N4O7 and a molecular weight of 514.58 g/mol. Its IUPAC name is (E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile;tert-butyl N-(2-amino-2-oxoethyl)carbamate.
| Compound Name | (E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile;tert-butyl N-(2-amino-2-oxoethyl)carbamate |
|---|---|
| PubChem CID | 22877895 |
| Molecular Formula | C26H34N4O7 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | (E)-3-(3-amino-4-methoxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enenitrile;tert-butyl N-(2-amino-2-oxoethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(N)=O.COc1ccc(/C=C(/C#N)c2cc(OC)c(OC)c(OC)c2)cc1N |
| InChI | InChI=1S/C19H20N2O4.C7H14N2O3/c1-22-16-6-5-12(8-15(16)21)7-14(11-20)13-9-17(23-2)19(25-4)18(10-13)24-3;1-7(2,3)12-6(11)9-4-5(8)10/h5-10H,21H2,1-4H3;4H2,1-3H3,(H2,8,10)(H,9,11)/b14-7-; |
| InChIKey | PMQBQVDHGPNDCC-KIUKIJHYSA-N |
| XLogP | 3.36 |
| TPSA | 168.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|