C25H28N2O8S — CID 77278786
[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylamino]phenyl] 2-(2H-pyridin-1-yl)acetate (PubChem CID 77278786) has the molecular formula C25H28N2O8S and a molecular weight of 516.57 g/mol. Its IUPAC name is [2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylamino]phenyl] 2-(2H-pyridin-1-yl)acetate.
| Compound Name | [2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylamino]phenyl] 2-(2H-pyridin-1-yl)acetate |
|---|---|
| PubChem CID | 77278786 |
| Molecular Formula | C25H28N2O8S |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | [2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylamino]phenyl] 2-(2H-pyridin-1-yl)acetate |
| SMILES | COc1cc(OC)c(C=CS(=O)(=O)Nc2ccc(OC)c(OC(=O)CN3C=CC=CC3)c2)c(OC)c1 |
| InChI | InChI=1S/C25H28N2O8S/c1-31-19-15-22(33-3)20(23(16-19)34-4)10-13-36(29,30)26-18-8-9-21(32-2)24(14-18)35-25(28)17-27-11-6-5-7-12-27/h5-11,13-16,26H,12,17H2,1-4H3 |
| InChIKey | QKSNXIOKVAQRQC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|