C14H15N5O6 — CID 118706460
1-(2,5-dimethoxyphenyl)-3-[(4-nitro-1H-pyrrole-2-carbonyl)amino]urea (PubChem CID 118706460) has the molecular formula C14H15N5O6 and a molecular weight of 349.30 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-[(4-nitro-1H-pyrrole-2-carbonyl)amino]urea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-[(4-nitro-1H-pyrrole-2-carbonyl)amino]urea |
|---|---|
| PubChem CID | 118706460 |
| Molecular Formula | C14H15N5O6 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-[(4-nitro-1H-pyrrole-2-carbonyl)amino]urea |
| SMILES | COc1ccc(OC)c(NC(=O)NNC(=O)c2cc([N+](=O)[O-])c[nH]2)c1 |
| InChI | InChI=1S/C14H15N5O6/c1-24-9-3-4-12(25-2)10(6-9)16-14(21)18-17-13(20)11-5-8(7-15-11)19(22)23/h3-7,15H,1-2H3,(H,17,20)(H2,16,18,21) |
| InChIKey | GFNOGARXPHUXOA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 147.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|