C26H27N3O5S — CID 42991798
3-(4-benzylpiperazin-1-yl)sulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide (PubChem CID 42991798) has the molecular formula C26H27N3O5S and a molecular weight of 493.59 g/mol. Its IUPAC name is 3-(4-benzylpiperazin-1-yl)sulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide.
| Compound Name | 3-(4-benzylpiperazin-1-yl)sulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide |
|---|---|
| PubChem CID | 42991798 |
| Molecular Formula | C26H27N3O5S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 3-(4-benzylpiperazin-1-yl)sulfonyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)c1cccc(S(=O)(=O)N2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H27N3O5S/c30-26(27-22-9-10-24-25(18-22)34-16-15-33-24)21-7-4-8-23(17-21)35(31,32)29-13-11-28(12-14-29)19-20-5-2-1-3-6-20/h1-10,17-18H,11-16,19H2,(H,27,30) |
| InChIKey | MNUBWUNTBLUPDE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |