C15H19N3O6S2 — CID 56586881
N-[1-(1,3-dioxoisoindol-5-yl)sulfonylpiperidin-4-yl]-N-methylmethanesulfonamide (PubChem CID 56586881) has the molecular formula C15H19N3O6S2 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[1-(1,3-dioxoisoindol-5-yl)sulfonylpiperidin-4-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[1-(1,3-dioxoisoindol-5-yl)sulfonylpiperidin-4-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 56586881 |
| Molecular Formula | C15H19N3O6S2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-[1-(1,3-dioxoisoindol-5-yl)sulfonylpiperidin-4-yl]-N-methylmethanesulfonamide |
| SMILES | CN(C1CCN(S(=O)(=O)c2ccc3c(c2)C(=O)NC3=O)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C15H19N3O6S2/c1-17(25(2,21)22)10-5-7-18(8-6-10)26(23,24)11-3-4-12-13(9-11)15(20)16-14(12)19/h3-4,9-10H,5-8H2,1-2H3,(H,16,19,20) |
| InChIKey | OLAMNPMYBVBNEZ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|