C18H17N3O5S2 — CID 56586749
N-[1-(1,3-dioxoisoindol-5-yl)sulfonylpiperidin-4-yl]thiophene-2-carboxamide (PubChem CID 56586749) has the molecular formula C18H17N3O5S2 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-[1-(1,3-dioxoisoindol-5-yl)sulfonylpiperidin-4-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-(1,3-dioxoisoindol-5-yl)sulfonylpiperidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 56586749 |
| Molecular Formula | C18H17N3O5S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | N-[1-(1,3-dioxoisoindol-5-yl)sulfonylpiperidin-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(NC1CCN(S(=O)(=O)c2ccc3c(c2)C(=O)NC3=O)CC1)c1cccs1 |
| InChI | InChI=1S/C18H17N3O5S2/c22-16-13-4-3-12(10-14(13)17(23)20-16)28(25,26)21-7-5-11(6-8-21)19-18(24)15-2-1-9-27-15/h1-4,9-11H,5-8H2,(H,19,24)(H,20,22,23) |
| InChIKey | AVGWJCMRASMACP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|