C21H21N3O7S2 — CID 16935227
N-(1,3-dioxoisoindol-5-yl)-1-(3-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 16935227) has the molecular formula C21H21N3O7S2 and a molecular weight of 491.55 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-5-yl)-1-(3-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-(1,3-dioxoisoindol-5-yl)-1-(3-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 16935227 |
| Molecular Formula | C21H21N3O7S2 |
| Molecular Weight | 491.55 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | N-(1,3-dioxoisoindol-5-yl)-1-(3-methylsulfonylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CS(=O)(=O)c1cccc(S(=O)(=O)N2CCC(C(=O)Nc3ccc4c(c3)C(=O)NC4=O)CC2)c1 |
| InChI | InChI=1S/C21H21N3O7S2/c1-32(28,29)15-3-2-4-16(12-15)33(30,31)24-9-7-13(8-10-24)19(25)22-14-5-6-17-18(11-14)21(27)23-20(17)26/h2-6,11-13H,7-10H2,1H3,(H,22,25)(H,23,26,27) |
| InChIKey | RWLRLSIBNDFLSV-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.55 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|