C19H21N3O7S2 — CID 16935188
1-(4-methylsulfonylphenyl)sulfonyl-N-(3-nitrophenyl)piperidine-4-carboxamide (PubChem CID 16935188) has the molecular formula C19H21N3O7S2 and a molecular weight of 467.53 g/mol. Its IUPAC name is 1-(4-methylsulfonylphenyl)sulfonyl-N-(3-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | 1-(4-methylsulfonylphenyl)sulfonyl-N-(3-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 16935188 |
| Molecular Formula | C19H21N3O7S2 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 1-(4-methylsulfonylphenyl)sulfonyl-N-(3-nitrophenyl)piperidine-4-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)Nc3cccc([N+](=O)[O-])c3)CC2)cc1 |
| InChI | InChI=1S/C19H21N3O7S2/c1-30(26,27)17-5-7-18(8-6-17)31(28,29)21-11-9-14(10-12-21)19(23)20-15-3-2-4-16(13-15)22(24)25/h2-8,13-14H,9-12H2,1H3,(H,20,23) |
| InChIKey | OWDCFKQHLHFUPH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|