C18H20ClF3N2O3S — CID 24517550
[4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-cyclohex-3-en-1-ylmethanone (PubChem CID 24517550) has the molecular formula C18H20ClF3N2O3S and a molecular weight of 436.88 g/mol. Its IUPAC name is [4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-cyclohex-3-en-1-ylmethanone.
| Compound Name | [4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-cyclohex-3-en-1-ylmethanone |
|---|---|
| PubChem CID | 24517550 |
| Molecular Formula | C18H20ClF3N2O3S |
| Molecular Weight | 436.88 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | [4-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]-cyclohex-3-en-1-ylmethanone |
| SMILES | O=C(C1CC=CCC1)N1CCN(S(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H20ClF3N2O3S/c19-16-7-6-14(12-15(16)18(20,21)22)28(26,27)24-10-8-23(9-11-24)17(25)13-4-2-1-3-5-13/h1-2,6-7,12-13H,3-5,8-11H2 |
| InChIKey | VDIVSRNTXKZTKL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.88 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|