C19H26N2O2S — CID 56574060
1-cyclohex-2-en-1-yl-4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazine (PubChem CID 56574060) has the molecular formula C19H26N2O2S and a molecular weight of 346.50 g/mol. Its IUPAC name is 1-cyclohex-2-en-1-yl-4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazine.
| Compound Name | 1-cyclohex-2-en-1-yl-4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazine |
|---|---|
| PubChem CID | 56574060 |
| Molecular Formula | C19H26N2O2S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-cyclohex-2-en-1-yl-4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazine |
| SMILES | O=S(=O)(c1ccc2c(c1)CCC2)N1CCN(C2C=CCCC2)CC1 |
| InChI | InChI=1S/C19H26N2O2S/c22-24(23,19-10-9-16-5-4-6-17(16)15-19)21-13-11-20(12-14-21)18-7-2-1-3-8-18/h2,7,9-10,15,18H,1,3-6,8,11-14H2 |
| InChIKey | RRIWSHKGZICYIO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|