C20H26N2O3S — CID 9183526
2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]ethanone (PubChem CID 9183526) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 9183526 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(2,3-dihydro-1H-inden-5-ylsulfonyl)piperazin-1-yl]ethanone |
| SMILES | O=C(C[C@H]1C=CCC1)N1CCN(S(=O)(=O)c2ccc3c(c2)CCC3)CC1 |
| InChI | InChI=1S/C20H26N2O3S/c23-20(14-16-4-1-2-5-16)21-10-12-22(13-11-21)26(24,25)19-9-8-17-6-3-7-18(17)15-19/h1,4,8-9,15-16H,2-3,5-7,10-14H2/t16-/m0/s1 |
| InChIKey | JTJHRXFCTYCBHL-INIZCTEOSA-N |
| XLogP | 2.36 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|