C18H21F3N2O3S — CID 9163663
2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethanone (PubChem CID 9163663) has the molecular formula C18H21F3N2O3S and a molecular weight of 402.44 g/mol. Its IUPAC name is 2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 9163663 |
| Molecular Formula | C18H21F3N2O3S |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]ethanone |
| SMILES | O=C(C[C@@H]1C=CCC1)N1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H21F3N2O3S/c19-18(20,21)15-5-7-16(8-6-15)27(25,26)23-11-9-22(10-12-23)17(24)13-14-3-1-2-4-14/h1,3,5-8,14H,2,4,9-13H2/t14-/m1/s1 |
| InChIKey | TZZPMYHKHZOHRL-CQSZACIVSA-N |
| XLogP | 2.89 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|