C17H20Cl2N2O3S — CID 9326898
2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 9326898) has the molecular formula C17H20Cl2N2O3S and a molecular weight of 403.33 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 9326898 |
| Molecular Formula | C17H20Cl2N2O3S |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-1-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | O=C(C[C@H]1C=CCC1)N1CCN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H20Cl2N2O3S/c18-15-6-5-14(12-16(15)19)25(23,24)21-9-7-20(8-10-21)17(22)11-13-3-1-2-4-13/h1,3,5-6,12-13H,2,4,7-11H2/t13-/m0/s1 |
| InChIKey | KXVYHKCDKZWSER-ZDUSSCGKSA-N |
| XLogP | 3.18 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|