C15H23N3O2S — CID 66203901
1-(azetidin-3-yl)-4-(3,4-dimethylphenyl)sulfonylpiperazine (PubChem CID 66203901) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-4-(3,4-dimethylphenyl)sulfonylpiperazine.
| Compound Name | 1-(azetidin-3-yl)-4-(3,4-dimethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 66203901 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1-(azetidin-3-yl)-4-(3,4-dimethylphenyl)sulfonylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C3CNC3)CC2)cc1C |
| InChI | InChI=1S/C15H23N3O2S/c1-12-3-4-15(9-13(12)2)21(19,20)18-7-5-17(6-8-18)14-10-16-11-14/h3-4,9,14,16H,5-8,10-11H2,1-2H3 |
| InChIKey | RWKRGEIBEMTMSF-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |