C22H29NO6S2 — CID 90592057
4-(4-methoxyphenyl)sulfonyl-1-[4-(2-methylpropoxy)phenyl]sulfonylpiperidine (PubChem CID 90592057) has the molecular formula C22H29NO6S2 and a molecular weight of 467.61 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfonyl-1-[4-(2-methylpropoxy)phenyl]sulfonylpiperidine.
| Compound Name | 4-(4-methoxyphenyl)sulfonyl-1-[4-(2-methylpropoxy)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 90592057 |
| Molecular Formula | C22H29NO6S2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfonyl-1-[4-(2-methylpropoxy)phenyl]sulfonylpiperidine |
| SMILES | COc1ccc(S(=O)(=O)C2CCN(S(=O)(=O)c3ccc(OCC(C)C)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H29NO6S2/c1-17(2)16-29-19-6-10-22(11-7-19)31(26,27)23-14-12-21(13-15-23)30(24,25)20-8-4-18(28-3)5-9-20/h4-11,17,21H,12-16H2,1-3H3 |
| InChIKey | BOPMTXGQVKSHAW-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |