C17H17ClFNO4S2 — CID 99903355
(3R)-1-(2-chlorophenyl)sulfonyl-3-(4-fluorophenyl)sulfonylpiperidine (PubChem CID 99903355) has the molecular formula C17H17ClFNO4S2 and a molecular weight of 417.91 g/mol. Its IUPAC name is (3R)-1-(2-chlorophenyl)sulfonyl-3-(4-fluorophenyl)sulfonylpiperidine.
| Compound Name | (3R)-1-(2-chlorophenyl)sulfonyl-3-(4-fluorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 99903355 |
| Molecular Formula | C17H17ClFNO4S2 |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | (3R)-1-(2-chlorophenyl)sulfonyl-3-(4-fluorophenyl)sulfonylpiperidine |
| SMILES | O=S(=O)(c1ccc(F)cc1)[C@@H]1CCCN(S(=O)(=O)c2ccccc2Cl)C1 |
| InChI | InChI=1S/C17H17ClFNO4S2/c18-16-5-1-2-6-17(16)26(23,24)20-11-3-4-15(12-20)25(21,22)14-9-7-13(19)8-10-14/h1-2,5-10,15H,3-4,11-12H2/t15-/m1/s1 |
| InChIKey | UPPHXMNBXJUDKR-OAHLLOKOSA-N |
| XLogP | 3.11 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |