C15H12Cl2FNO4S2 — CID 90593256
1-(2,6-dichlorophenyl)sulfonyl-3-(4-fluorophenyl)sulfonylazetidine (PubChem CID 90593256) has the molecular formula C15H12Cl2FNO4S2 and a molecular weight of 424.30 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)sulfonyl-3-(4-fluorophenyl)sulfonylazetidine.
| Compound Name | 1-(2,6-dichlorophenyl)sulfonyl-3-(4-fluorophenyl)sulfonylazetidine |
|---|---|
| PubChem CID | 90593256 |
| Molecular Formula | C15H12Cl2FNO4S2 |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 422.96 |
| IUPAC Name | 1-(2,6-dichlorophenyl)sulfonyl-3-(4-fluorophenyl)sulfonylazetidine |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1CN(S(=O)(=O)c2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C15H12Cl2FNO4S2/c16-13-2-1-3-14(17)15(13)25(22,23)19-8-12(9-19)24(20,21)11-6-4-10(18)5-7-11/h1-7,12H,8-9H2 |
| InChIKey | BBXOPJBFSYBQET-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |