C18H28N2O3S2 — CID 60604892
N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-tert-butylsulfanylacetamide (PubChem CID 60604892) has the molecular formula C18H28N2O3S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-tert-butylsulfanylacetamide.
| Compound Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-tert-butylsulfanylacetamide |
|---|---|
| PubChem CID | 60604892 |
| Molecular Formula | C18H28N2O3S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-tert-butylsulfanylacetamide |
| SMILES | CC(C)(C)SCC(=O)NCC1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H28N2O3S2/c1-18(2,3)24-14-17(21)19-13-15-9-11-20(12-10-15)25(22,23)16-7-5-4-6-8-16/h4-8,15H,9-14H2,1-3H3,(H,19,21) |
| InChIKey | CEKUDYNLQIIPGI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |