C19H26N2O3S — CID 47086847
N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-cyclopent-2-en-1-ylacetamide (PubChem CID 47086847) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-cyclopent-2-en-1-ylacetamide.
| Compound Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-cyclopent-2-en-1-ylacetamide |
|---|---|
| PubChem CID | 47086847 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-cyclopent-2-en-1-ylacetamide |
| SMILES | O=C(CC1C=CCC1)NCC1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H26N2O3S/c22-19(14-16-6-4-5-7-16)20-15-17-10-12-21(13-11-17)25(23,24)18-8-2-1-3-9-18/h1-4,6,8-9,16-17H,5,7,10-15H2,(H,20,22) |
| InChIKey | JNYPQYAQXOBFTM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|