C19H30N2O3S2 — CID 49065427
N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-butylsulfanylpropanamide (PubChem CID 49065427) has the molecular formula C19H30N2O3S2 and a molecular weight of 398.59 g/mol. Its IUPAC name is N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-butylsulfanylpropanamide.
| Compound Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-butylsulfanylpropanamide |
|---|---|
| PubChem CID | 49065427 |
| Molecular Formula | C19H30N2O3S2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-2-butylsulfanylpropanamide |
| SMILES | CCCCSC(C)C(=O)NCC1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H30N2O3S2/c1-3-4-14-25-16(2)19(22)20-15-17-10-12-21(13-11-17)26(23,24)18-8-6-5-7-9-18/h5-9,16-17H,3-4,10-15H2,1-2H3,(H,20,22) |
| InChIKey | WPQAKOZSIAIYJP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|