C26H27N3O4S — CID 38357882
N-benzyl-3-(3-oxopiperazin-1-yl)sulfonyl-N-(2-phenylethyl)benzamide (PubChem CID 38357882) has the molecular formula C26H27N3O4S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-benzyl-3-(3-oxopiperazin-1-yl)sulfonyl-N-(2-phenylethyl)benzamide.
| Compound Name | N-benzyl-3-(3-oxopiperazin-1-yl)sulfonyl-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 38357882 |
| Molecular Formula | C26H27N3O4S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-benzyl-3-(3-oxopiperazin-1-yl)sulfonyl-N-(2-phenylethyl)benzamide |
| SMILES | O=C1CN(S(=O)(=O)c2cccc(C(=O)N(CCc3ccccc3)Cc3ccccc3)c2)CCN1 |
| InChI | InChI=1S/C26H27N3O4S/c30-25-20-29(17-15-27-25)34(32,33)24-13-7-12-23(18-24)26(31)28(19-22-10-5-2-6-11-22)16-14-21-8-3-1-4-9-21/h1-13,18H,14-17,19-20H2,(H,27,30) |
| InChIKey | PTLZAZUPMGHHFB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |