C21H23N3O6S — CID 42946802
methyl 2-[[3-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]-3-phenylpropanoate (PubChem CID 42946802) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is methyl 2-[[3-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[3-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 42946802 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | methyl 2-[[3-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)c1cccc(S(=O)(=O)N2CCNC(=O)C2)c1 |
| InChI | InChI=1S/C21H23N3O6S/c1-30-21(27)18(12-15-6-3-2-4-7-15)23-20(26)16-8-5-9-17(13-16)31(28,29)24-11-10-22-19(25)14-24/h2-9,13,18H,10-12,14H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | UTKBMCIAPXVRIH-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |