C23H29N3O4S — CID 46556309
N-[1-[4-(2-methylpropyl)phenyl]ethyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide (PubChem CID 46556309) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[1-[4-(2-methylpropyl)phenyl]ethyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-[1-[4-(2-methylpropyl)phenyl]ethyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 46556309 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N-[1-[4-(2-methylpropyl)phenyl]ethyl]-3-(3-oxopiperazin-1-yl)sulfonylbenzamide |
| SMILES | CC(C)Cc1ccc(C(C)NC(=O)c2cccc(S(=O)(=O)N3CCNC(=O)C3)c2)cc1 |
| InChI | InChI=1S/C23H29N3O4S/c1-16(2)13-18-7-9-19(10-8-18)17(3)25-23(28)20-5-4-6-21(14-20)31(29,30)26-12-11-24-22(27)15-26/h4-10,14,16-17H,11-13,15H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | SXYXWBQFEUCSKG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |