C17H27ClN4O4S — CID 119588607
N-(1-amino-4-methylpentan-2-yl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide;hydrochloride (PubChem CID 119588607) has the molecular formula C17H27ClN4O4S and a molecular weight of 418.95 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119588607 |
| Molecular Formula | C17H27ClN4O4S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-3-(3-oxopiperazin-1-yl)sulfonylbenzamide;hydrochloride |
| SMILES | CC(C)CC(CN)NC(=O)c1cccc(S(=O)(=O)N2CCNC(=O)C2)c1.Cl |
| InChI | InChI=1S/C17H26N4O4S.ClH/c1-12(2)8-14(10-18)20-17(23)13-4-3-5-15(9-13)26(24,25)21-7-6-19-16(22)11-21;/h3-5,9,12,14H,6-8,10-11,18H2,1-2H3,(H,19,22)(H,20,23);1H |
| InChIKey | DIHRHWZHTVGADT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |