C20H23N3O6S2 — CID 43053593
ethyl 5-ethyl-2-[[3-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]thiophene-3-carboxylate (PubChem CID 43053593) has the molecular formula C20H23N3O6S2 and a molecular weight of 465.55 g/mol. Its IUPAC name is ethyl 5-ethyl-2-[[3-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-ethyl-2-[[3-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 43053593 |
| Molecular Formula | C20H23N3O6S2 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | ethyl 5-ethyl-2-[[3-(3-oxopiperazin-1-yl)sulfonylbenzoyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=O)c1cccc(S(=O)(=O)N2CCNC(=O)C2)c1 |
| InChI | InChI=1S/C20H23N3O6S2/c1-3-14-11-16(20(26)29-4-2)19(30-14)22-18(25)13-6-5-7-15(10-13)31(27,28)23-9-8-21-17(24)12-23/h5-7,10-11H,3-4,8-9,12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | YTAWQXVZIWTUNK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |