C22H28N2O4S2 — CID 55918847
N-[(4-methoxyphenyl)methyl]-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)-N-prop-2-enylacetamide (PubChem CID 55918847) has the molecular formula C22H28N2O4S2 and a molecular weight of 448.61 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)-N-prop-2-enylacetamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 55918847 |
| Molecular Formula | C22H28N2O4S2 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-(5-piperidin-1-ylsulfonylthiophen-2-yl)-N-prop-2-enylacetamide |
| SMILES | C=CCN(Cc1ccc(OC)cc1)C(=O)Cc1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C22H28N2O4S2/c1-3-13-23(17-18-7-9-19(28-2)10-8-18)21(25)16-20-11-12-22(29-20)30(26,27)24-14-5-4-6-15-24/h3,7-12H,1,4-6,13-17H2,2H3 |
| InChIKey | HYMUTUKXOCOJCG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|