C14H20N2O5S2 — CID 119208948
2-[methyl-[2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetyl]amino]propanoic acid (PubChem CID 119208948) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 2-[methyl-[2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetyl]amino]propanoic acid.
| Compound Name | 2-[methyl-[2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119208948 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-[methyl-[2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)Cc1ccc(S(=O)(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C14H20N2O5S2/c1-10(14(18)19)15(2)12(17)9-11-5-6-13(22-11)23(20,21)16-7-3-4-8-16/h5-6,10H,3-4,7-9H2,1-2H3,(H,18,19) |
| InChIKey | XEHPIRDVXQSVNF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |