C18H40N6O — CID 111653214
1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine (PubChem CID 111653214) has the molecular formula C18H40N6O and a molecular weight of 356.56 g/mol. Its IUPAC name is 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111653214 |
| Molecular Formula | C18H40N6O |
| Molecular Weight | 356.56 g/mol |
| Exact Mass | 356.33 |
| IUPAC Name | 1-ethyl-3-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCN1CCCN(C)CC1)NCCN(C)CCCOC |
| InChI | InChI=1S/C18H40N6O/c1-5-19-18(20-8-13-22(2)11-7-17-25-4)21-9-14-24-12-6-10-23(3)15-16-24/h5-17H2,1-4H3,(H2,19,20,21) |
| InChIKey | XZYHTXONGCIJHE-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.56 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|