C16H36IN5 — CID 110965667
1-tert-butyl-3-ethyl-2-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide (PubChem CID 110965667) has the molecular formula C16H36IN5 and a molecular weight of 425.40 g/mol. Its IUPAC name is 1-tert-butyl-3-ethyl-2-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-3-ethyl-2-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110965667 |
| Molecular Formula | C16H36IN5 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 1-tert-butyl-3-ethyl-2-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCCN(C)CC1)NC(C)(C)C.I |
| InChI | InChI=1S/C16H35N5.HI/c1-6-17-15(19-16(2,3)4)18-9-7-11-21-12-8-10-20(5)13-14-21;/h6-14H2,1-5H3,(H2,17,18,19);1H |
| InChIKey | AJDGERXYFUPRGK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|