C19H26FIN4OS — CID 111351181
N-[2-[[N-ethyl-N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide (PubChem CID 111351181) has the molecular formula C19H26FIN4OS and a molecular weight of 504.41 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111351181 |
| Molecular Formula | C19H26FIN4OS |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | N-[2-[[N-ethyl-N'-(2-thiophen-2-ylethyl)carbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1cccs1)NCCNC(=O)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C19H25FN4OS.HI/c1-2-21-19(23-10-9-17-4-3-13-26-17)24-12-11-22-18(25)14-15-5-7-16(20)8-6-15;/h3-8,13H,2,9-12,14H2,1H3,(H,22,25)(H2,21,23,24);1H |
| InChIKey | KSVOZGHRZZMFBN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|