C20H27FN4OS — CID 111673748
2-(4-fluorophenyl)-N-[2-[[N'-methyl-N-(2-methyl-3-thiophen-2-ylpropyl)carbamimidoyl]amino]ethyl]acetamide (PubChem CID 111673748) has the molecular formula C20H27FN4OS and a molecular weight of 390.53 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[2-[[N'-methyl-N-(2-methyl-3-thiophen-2-ylpropyl)carbamimidoyl]amino]ethyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[2-[[N'-methyl-N-(2-methyl-3-thiophen-2-ylpropyl)carbamimidoyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 111673748 |
| Molecular Formula | C20H27FN4OS |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[2-[[N'-methyl-N-(2-methyl-3-thiophen-2-ylpropyl)carbamimidoyl]amino]ethyl]acetamide |
| SMILES | C/N=C(/NCCNC(=O)Cc1ccc(F)cc1)NCC(C)Cc1cccs1 |
| InChI | InChI=1S/C20H27FN4OS/c1-15(12-18-4-3-11-27-18)14-25-20(22-2)24-10-9-23-19(26)13-16-5-7-17(21)8-6-16/h3-8,11,15H,9-10,12-14H2,1-2H3,(H,23,26)(H2,22,24,25) |
| InChIKey | BQXHAMIHKRXISG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|