C21H23FN2O2 — CID 30741134
(2S)-N-[[5-(2-fluorophenyl)furan-2-yl]methyl]-2-(furan-2-yl)-2-pyrrolidin-1-ylethanamine (PubChem CID 30741134) has the molecular formula C21H23FN2O2 and a molecular weight of 354.43 g/mol. Its IUPAC name is (2S)-N-[[5-(2-fluorophenyl)furan-2-yl]methyl]-2-(furan-2-yl)-2-pyrrolidin-1-ylethanamine.
| Compound Name | (2S)-N-[[5-(2-fluorophenyl)furan-2-yl]methyl]-2-(furan-2-yl)-2-pyrrolidin-1-ylethanamine |
|---|---|
| PubChem CID | 30741134 |
| Molecular Formula | C21H23FN2O2 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (2S)-N-[[5-(2-fluorophenyl)furan-2-yl]methyl]-2-(furan-2-yl)-2-pyrrolidin-1-ylethanamine |
| SMILES | Fc1ccccc1-c1ccc(CNC[C@@H](c2ccco2)N2CCCC2)o1 |
| InChI | InChI=1S/C21H23FN2O2/c22-18-7-2-1-6-17(18)20-10-9-16(26-20)14-23-15-19(21-8-5-13-25-21)24-11-3-4-12-24/h1-2,5-10,13,19,23H,3-4,11-12,14-15H2/t19-/m0/s1 |
| InChIKey | VGCUQQDPHMDYCV-IBGZPJMESA-N |
| XLogP | 4.61 |
| TPSA | 41.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |