C12H13F2N — CID 104806918
N-[(2,5-difluorophenyl)methyl]pent-3-yn-1-amine (PubChem CID 104806918) has the molecular formula C12H13F2N and a molecular weight of 209.24 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]pent-3-yn-1-amine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]pent-3-yn-1-amine |
|---|---|
| PubChem CID | 104806918 |
| Molecular Formula | C12H13F2N |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]pent-3-yn-1-amine |
| SMILES | CC#CCCNCc1cc(F)ccc1F |
| InChI | InChI=1S/C12H13F2N/c1-2-3-4-7-15-9-10-8-11(13)5-6-12(10)14/h5-6,8,15H,4,7,9H2,1H3 |
| InChIKey | NANGLDNVRHRXQM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|