C13H15F2N — CID 104758066
N-[1-(2,5-difluorophenyl)ethyl]pent-3-yn-1-amine (PubChem CID 104758066) has the molecular formula C13H15F2N and a molecular weight of 223.27 g/mol. Its IUPAC name is N-[1-(2,5-difluorophenyl)ethyl]pent-3-yn-1-amine.
| Compound Name | N-[1-(2,5-difluorophenyl)ethyl]pent-3-yn-1-amine |
|---|---|
| PubChem CID | 104758066 |
| Molecular Formula | C13H15F2N |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | N-[1-(2,5-difluorophenyl)ethyl]pent-3-yn-1-amine |
| SMILES | CC#CCCNC(C)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H15F2N/c1-3-4-5-8-16-10(2)12-9-11(14)6-7-13(12)15/h6-7,9-10,16H,5,8H2,1-2H3 |
| InChIKey | MWCHIUGTFKVIHM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|