C11H15F2NS — CID 63983699
1-(2,5-difluorophenyl)-N-(2-methylsulfanylethyl)ethanamine (PubChem CID 63983699) has the molecular formula C11H15F2NS and a molecular weight of 231.31 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-N-(2-methylsulfanylethyl)ethanamine.
| Compound Name | 1-(2,5-difluorophenyl)-N-(2-methylsulfanylethyl)ethanamine |
|---|---|
| PubChem CID | 63983699 |
| Molecular Formula | C11H15F2NS |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 1-(2,5-difluorophenyl)-N-(2-methylsulfanylethyl)ethanamine |
| SMILES | CSCCNC(C)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H15F2NS/c1-8(14-5-6-15-2)10-7-9(12)3-4-11(10)13/h3-4,7-8,14H,5-6H2,1-2H3 |
| InChIKey | CYJPHSQIGLTBKW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|