C12H13F2N — CID 104805650
1-(2,5-difluorophenyl)hex-4-yn-1-amine (PubChem CID 104805650) has the molecular formula C12H13F2N and a molecular weight of 209.24 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)hex-4-yn-1-amine.
| Compound Name | 1-(2,5-difluorophenyl)hex-4-yn-1-amine |
|---|---|
| PubChem CID | 104805650 |
| Molecular Formula | C12H13F2N |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1-(2,5-difluorophenyl)hex-4-yn-1-amine |
| SMILES | CC#CCCC(N)c1cc(F)ccc1F |
| InChI | InChI=1S/C12H13F2N/c1-2-3-4-5-12(15)10-8-9(13)6-7-11(10)14/h6-8,12H,4-5,15H2,1H3 |
| InChIKey | DPZQONSVHVMZCV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|