C13H14N4OS2 — CID 106035388
5-carbamothioyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyridine-2-carboxamide (PubChem CID 106035388) has the molecular formula C13H14N4OS2 and a molecular weight of 306.42 g/mol. Its IUPAC name is 5-carbamothioyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyridine-2-carboxamide.
| Compound Name | 5-carbamothioyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 106035388 |
| Molecular Formula | C13H14N4OS2 |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 5-carbamothioyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyridine-2-carboxamide |
| SMILES | Cc1nc(CCNC(=O)c2ccc(C(N)=S)cn2)cs1 |
| InChI | InChI=1S/C13H14N4OS2/c1-8-17-10(7-20-8)4-5-15-13(18)11-3-2-9(6-16-11)12(14)19/h2-3,6-7H,4-5H2,1H3,(H2,14,19)(H,15,18) |
| InChIKey | OFFAPFQVHSBLHL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|