C11H14N6OS — CID 106040179
6-hydrazinyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide (PubChem CID 106040179) has the molecular formula C11H14N6OS and a molecular weight of 278.34 g/mol. Its IUPAC name is 6-hydrazinyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide.
| Compound Name | 6-hydrazinyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 106040179 |
| Molecular Formula | C11H14N6OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 6-hydrazinyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]pyrazine-2-carboxamide |
| SMILES | Cc1nc(CCNC(=O)c2cncc(NN)n2)cs1 |
| InChI | InChI=1S/C11H14N6OS/c1-7-15-8(6-19-7)2-3-14-11(18)9-4-13-5-10(16-9)17-12/h4-6H,2-3,12H2,1H3,(H,14,18)(H,16,17) |
| InChIKey | RQXYZJRLDMUFHZ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|