C15H17N3OS2 — CID 106035385
2-(4-carbamothioylphenyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]acetamide (PubChem CID 106035385) has the molecular formula C15H17N3OS2 and a molecular weight of 319.46 g/mol. Its IUPAC name is 2-(4-carbamothioylphenyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]acetamide.
| Compound Name | 2-(4-carbamothioylphenyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 106035385 |
| Molecular Formula | C15H17N3OS2 |
| Molecular Weight | 319.46 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-(4-carbamothioylphenyl)-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]acetamide |
| SMILES | Cc1nc(CCNC(=O)Cc2ccc(C(N)=S)cc2)cs1 |
| InChI | InChI=1S/C15H17N3OS2/c1-10-18-13(9-21-10)6-7-17-14(19)8-11-2-4-12(5-3-11)15(16)20/h2-5,9H,6-8H2,1H3,(H2,16,20)(H,17,19) |
| InChIKey | ZDGIYHOUJRAQLT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|