C12H19N3OS2 — CID 114139132
2-carbamothioyl-3-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]butanamide (PubChem CID 114139132) has the molecular formula C12H19N3OS2 and a molecular weight of 285.44 g/mol. Its IUPAC name is 2-carbamothioyl-3-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]butanamide.
| Compound Name | 2-carbamothioyl-3-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 114139132 |
| Molecular Formula | C12H19N3OS2 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-carbamothioyl-3-methyl-N-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]butanamide |
| SMILES | Cc1nc(CCNC(=O)C(C(N)=S)C(C)C)cs1 |
| InChI | InChI=1S/C12H19N3OS2/c1-7(2)10(11(13)17)12(16)14-5-4-9-6-18-8(3)15-9/h6-7,10H,4-5H2,1-3H3,(H2,13,17)(H,14,16) |
| InChIKey | YZDKUEBFIZKIIF-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|