C18H15ClN2O4S — CID 42039268
(7,8-dimethyl-2-oxochromen-4-yl)methyl 5-chloro-2-methylsulfanylpyrimidine-4-carboxylate (PubChem CID 42039268) has the molecular formula C18H15ClN2O4S and a molecular weight of 390.85 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 5-chloro-2-methylsulfanylpyrimidine-4-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 5-chloro-2-methylsulfanylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 42039268 |
| Molecular Formula | C18H15ClN2O4S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 5-chloro-2-methylsulfanylpyrimidine-4-carboxylate |
| SMILES | CSc1ncc(Cl)c(C(=O)OCc2cc(=O)oc3c(C)c(C)ccc23)n1 |
| InChI | InChI=1S/C18H15ClN2O4S/c1-9-4-5-12-11(6-14(22)25-16(12)10(9)2)8-24-17(23)15-13(19)7-20-18(21-15)26-3/h4-7H,8H2,1-3H3 |
| InChIKey | ZKZCJFVCVGOMGE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|