C24H19NO4 — CID 40584912
(7,8-dimethyl-2-oxochromen-4-yl)methyl (E)-3-quinolin-2-ylprop-2-enoate (PubChem CID 40584912) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl (E)-3-quinolin-2-ylprop-2-enoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (E)-3-quinolin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 40584912 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (E)-3-quinolin-2-ylprop-2-enoate |
| SMILES | Cc1ccc2c(COC(=O)/C=C/c3ccc4ccccc4n3)cc(=O)oc2c1C |
| InChI | InChI=1S/C24H19NO4/c1-15-7-11-20-18(13-23(27)29-24(20)16(15)2)14-28-22(26)12-10-19-9-8-17-5-3-4-6-21(17)25-19/h3-13H,14H2,1-2H3/b12-10+ |
| InChIKey | ZQCLMLWLSQDYCL-ZRDIBKRKSA-N |
| XLogP | 4.71 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|