C22H19ClO5 — CID 8643120
(7,8-dimethyl-2-oxochromen-4-yl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate (PubChem CID 8643120) has the molecular formula C22H19ClO5 and a molecular weight of 398.84 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 8643120 |
| Molecular Formula | C22H19ClO5 |
| Molecular Weight | 398.84 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (3S)-6-chloro-3,4-dihydro-2H-chromene-3-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)[C@@H]3COc4ccc(Cl)cc4C3)cc(=O)oc2c1C |
| InChI | InChI=1S/C22H19ClO5/c1-12-3-5-18-15(9-20(24)28-21(18)13(12)2)10-27-22(25)16-7-14-8-17(23)4-6-19(14)26-11-16/h3-6,8-9,16H,7,10-11H2,1-2H3/t16-/m0/s1 |
| InChIKey | HKTUKIUTHSPCLU-INIZCTEOSA-N |
| XLogP | 4.36 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.84 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|