C27H23NO6 — CID 55937358
(7,8-dimethyl-2-oxochromen-4-yl)methyl (3S)-2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate (PubChem CID 55937358) has the molecular formula C27H23NO6 and a molecular weight of 457.48 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl (3S)-2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (3S)-2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 55937358 |
| Molecular Formula | C27H23NO6 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (3S)-2-(furan-2-carbonyl)-3,4-dihydro-1H-isoquinoline-3-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)[C@@H]3Cc4ccccc4CN3C(=O)c3ccco3)cc(=O)oc2c1C |
| InChI | InChI=1S/C27H23NO6/c1-16-9-10-21-20(13-24(29)34-25(21)17(16)2)15-33-27(31)22-12-18-6-3-4-7-19(18)14-28(22)26(30)23-8-5-11-32-23/h3-11,13,22H,12,14-15H2,1-2H3/t22-/m0/s1 |
| InChIKey | AKWYCALYHROLBZ-QFIPXVFZSA-N |
| XLogP | 4.31 |
| TPSA | 89.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|