C22H18N2O6S2 — CID 46660610
[7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate (PubChem CID 46660610) has the molecular formula C22H18N2O6S2 and a molecular weight of 470.53 g/mol. Its IUPAC name is [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate.
| Compound Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 46660610 |
| Molecular Formula | C22H18N2O6S2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | [7-(ethoxycarbonylamino)-2-oxochromen-4-yl]methyl 4-methyl-2-thiophen-3-yl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)Nc1ccc2c(COC(=O)c3sc(-c4ccsc4)nc3C)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H18N2O6S2/c1-3-28-22(27)24-15-4-5-16-14(8-18(25)30-17(16)9-15)10-29-21(26)19-12(2)23-20(32-19)13-6-7-31-11-13/h4-9,11H,3,10H2,1-2H3,(H,24,27) |
| InChIKey | KCIJCAOEDDBEFY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|