C15H12N2O5S — CID 8535591
(7-hydroxy-2-oxochromen-4-yl)methyl 4-ethylthiadiazole-5-carboxylate (PubChem CID 8535591) has the molecular formula C15H12N2O5S and a molecular weight of 332.34 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl 4-ethylthiadiazole-5-carboxylate.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl 4-ethylthiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 8535591 |
| Molecular Formula | C15H12N2O5S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl 4-ethylthiadiazole-5-carboxylate |
| SMILES | CCc1nnsc1C(=O)OCc1cc(=O)oc2cc(O)ccc12 |
| InChI | InChI=1S/C15H12N2O5S/c1-2-11-14(23-17-16-11)15(20)21-7-8-5-13(19)22-12-6-9(18)3-4-10(8)12/h3-6,18H,2,7H2,1H3 |
| InChIKey | SAQSBHMQQDZBKO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|