C21H26N4O3S — CID 78817001
4-ethoxy-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-piperidin-1-ylsulfonylaniline (PubChem CID 78817001) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is 4-ethoxy-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-piperidin-1-ylsulfonylaniline.
| Compound Name | 4-ethoxy-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-piperidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 78817001 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 4-ethoxy-N-(imidazo[1,2-a]pyridin-2-ylmethyl)-3-piperidin-1-ylsulfonylaniline |
| SMILES | CCOc1ccc(NCc2cn3ccccc3n2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H26N4O3S/c1-2-28-19-10-9-17(14-20(19)29(26,27)25-12-5-3-6-13-25)22-15-18-16-24-11-7-4-8-21(24)23-18/h4,7-11,14,16,22H,2-3,5-6,12-13,15H2,1H3 |
| InChIKey | WCCWCQBCIJBNCT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|