C22H26N4O4S — CID 78793301
4-ethoxy-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-piperidin-1-ylsulfonylaniline (PubChem CID 78793301) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 4-ethoxy-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-piperidin-1-ylsulfonylaniline.
| Compound Name | 4-ethoxy-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-piperidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 78793301 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 4-ethoxy-N-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3-piperidin-1-ylsulfonylaniline |
| SMILES | CCOc1ccc(NCc2nnc(-c3ccccc3)o2)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C22H26N4O4S/c1-2-29-19-12-11-18(15-20(19)31(27,28)26-13-7-4-8-14-26)23-16-21-24-25-22(30-21)17-9-5-3-6-10-17/h3,5-6,9-12,15,23H,2,4,7-8,13-14,16H2,1H3 |
| InChIKey | UFBAAGXWTJBSNW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|